CAS 96563-01-8

S-(2-chloro-1,1,2-trifluoroethyl)-L-cysteine

Description:

S-(2-chloro-1,1,2-trifluoroethyl)-L-cysteine, with the CAS number 96563-01-8, is a synthetic amino acid derivative of cysteine, characterized by the presence of a chloro and trifluoroethyl group attached to the sulfur atom of the cysteine backbone. This compound is notable for its unique functional groups, which impart distinct chemical properties, such as increased hydrophobicity and potential reactivity in biological systems. The trifluoroethyl group can enhance lipophilicity, influencing the compound's solubility and interaction with biological membranes. Additionally, the presence of the chlorine atom may contribute to its reactivity, making it a candidate for various chemical transformations. As a cysteine derivative, it retains the thiol (-SH) group, which is crucial for redox reactions and can participate in the formation of disulfide bonds. This compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways or as a tool in biochemical research. However, its specific biological activity and safety profile would require further investigation.

Formula: C₅H₇ClF₃NO₂S

InChI: InChI=1/C5H7ClF3NO2S/c6-4(7)5(8,9)13-1-2(10)3(11)12/h2,4H,1,10H2,(H,11,12)/t2-,4?/m0/s1

SMILES: C([C@@H](C(=O)O)N)SC(C(Cl)F)(F)F

Synonyms:

• L-cysteine, S-(2-chloro-1,1,2-trifluoroethyl)-