CAS 96591-94-5

4-[(1-methyl-1H-imidazol-2-yl)sulfanyl]aniline

Description:

4-[(1-Methyl-1H-imidazol-2-yl)sulfanyl]aniline, with the CAS number 96591-94-5, is an organic compound characterized by the presence of an aniline group substituted with a sulfanyl (thioether) moiety linked to a 1-methyl-1H-imidazole ring. This compound features a sulfur atom bonded to the imidazole nitrogen, contributing to its unique chemical properties. It typically exhibits moderate solubility in polar solvents due to the presence of both hydrophobic (the aromatic aniline) and hydrophilic (the imidazole) components. The imidazole ring can participate in hydrogen bonding and may exhibit basic properties, while the aniline portion can act as a weak base due to the amino group. The compound may also display biological activity, making it of interest in pharmaceutical research. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.

Formula: C₁₀H₁₁N₃S

InChI: InChI=1/C10H11N3S/c1-13-7-6-12-10(13)14-9-4-2-8(11)3-5-9/h2-7H,11H2,1H3

SMILES: Cn1ccnc1Sc1ccc(cc1)N

Synonyms:

• 4-[(1-Methyl-1H-imidazol-2-yl)sulfanyl]phenylamine
• 4-[(1-methyl-1H-imidazol-2-yl)thio]aniline

4-[1-Methyl-1H-imidazol-2-yl)thio]aniline

CAS: 96591-94-5

4-[1-Methyl-1H-imidazol-2-yl)thio]aniline

Purity: ≥95%

Molecular weight: 205.28g/mol

Ref: 54-OR17863