CAS 96594-10-4
:N-(4-methyl-2-oxo-2H-chromen-7-yl)-L-alaninamide trifluoroacetate
Description:
N-(4-methyl-2-oxo-2H-chromen-7-yl)-L-alaninamide trifluoroacetate, with the CAS number 96594-10-4, is a chemical compound that features a chromenone moiety, which is a fused benzopyran structure known for its diverse biological activities. This compound contains an alaninamide functional group, indicating the presence of an amine and a carboxylic acid derivative, which can influence its solubility and reactivity. The trifluoroacetate group enhances its stability and solubility in organic solvents, making it useful in various chemical applications. The presence of the methyl and oxo groups contributes to its unique electronic properties, potentially affecting its interaction with biological targets. Compounds like this are often studied for their potential pharmacological effects, including anti-inflammatory and antioxidant activities. Overall, the structural features of this compound suggest it may have interesting applications in medicinal chemistry and drug development, although specific biological activities would require further investigation.
Formula:C15H15F3N2O5
InChI:InChI=1/C13H14N2O3.C2HF3O2/c1-7-5-12(16)18-11-6-9(3-4-10(7)11)15-13(17)8(2)14;3-2(4,5)1(6)7/h3-6,8H,14H2,1-2H3,(H,15,17);(H,6,7)/t8-;/m0./s1
SMILES:Cc1cc(=O)oc2cc(ccc12)N=C([C@H](C)N)O.C(=O)(C(F)(F)F)O
Synonyms:- L-Alanine 7-amido-4-methylcoumarin trifluoroacetate
- (2S)-1-[(4-methyl-2-oxo-2H-chromen-7-yl)amino]-1-oxopropan-2-aminium
- H-Ala-Amc Tfa
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Propanamide, 2-amino-N-(4-methyl-2-oxo-2H-1-benzopyran-7-yl)-,(2S)-, mono(trifluoroacetate)
CAS:Formula:C15H15F3N2O5Purity:98%Color and Shape:SolidMolecular weight:360.2852L-Alanine 7-amido-4-methylcoumarin trifluoroacetate salt
CAS:L-Alanine 7-amido-4-methylcoumarin trifluoroacetate saltFormula:C13H14N2O3·CF3CO2HPurity:By hplc: >98% (Typical Value in Batch COA)Color and Shape: white powderMolecular weight:360.2852g/molL-Alanine-7-amido-4-methylcoumarin trifluoroacetic acid salt
CAS:Formula:C15H15F3N2O5Purity:≥ 98.0%Color and Shape:White to off-white powderMolecular weight:360.290L-Alanine 7-amido-4-methylcoumarin, trifluoroacetate salt
CAS:Fluorogenic substrate for aminopeptidase yielding a blue fluorescent solution.Formula:C15H15F3N2O5Purity:Min. 98.0 Area-%Molecular weight:360.29 g/molL-Alanine-7-Amido-4-Methylcoumarin Trifluoroacetate Salt extrapure, 98%
CAS:Formula:C15H15F3N2O5Purity:min. 98%Color and Shape:White, Crystalline powderMolecular weight:360.3L-Alanine 7-Amido-4-methylcoumarin, Trifluoroacetate Salt
CAS:Controlled ProductFormula:C13H14N2O3•C2HF3O2Color and Shape:NeatMolecular weight:246.26+(114.02)






