CAS 96605-61-7
:N-[3-[3-(Dimethylamino)-1-oxo-2-propen-1-yl]phenyl]acetamide
Description:
N-[3-[3-(Dimethylamino)-1-oxo-2-propen-1-yl]phenyl]acetamide, with the CAS number 96605-61-7, is a synthetic organic compound characterized by its complex structure, which includes an acetamide functional group and a dimethylamino moiety. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential reactivity due to the presence of the carbonyl group. The dimethylamino group contributes to its basicity and may influence its biological activity, making it of interest in pharmaceutical research. The presence of the propenyl group suggests potential for further chemical reactivity, such as polymerization or addition reactions. Overall, this compound's unique structural features may confer specific pharmacological properties, making it a candidate for further investigation in medicinal chemistry. As with many organic compounds, its stability, reactivity, and interactions with biological systems would depend on environmental conditions and the presence of other chemical species.
Formula:C13H16N2O2
InChI:InChI=1/C13H16N2O2/c1-10(16)14-12-6-4-5-11(9-12)13(17)7-8-15(2)3/h4-9H,1-3H3,(H,14,16)
InChI key:InChIKey=AIWCFDGABJPHDI-UHFFFAOYSA-N
SMILES:C(C=CN(C)C)(=O)C1=CC(NC(C)=O)=CC=C1
Synonyms:- Acetamide, N-[3-[3-(dimethylamino)-1-oxo-2-propenyl]phenyl]-
- N-[3-[3-(Dimethylamino)-1-oxo-2-propen-1-yl]phenyl]acetamide
- Acetamide, N-[3-[3-(dimethylamino)-1-oxo-2-propen-1-yl]phenyl]-
- N-[3-(3-Dimethylaminoacryloyl)phenyl]acetamide
- 3-Dimethylamino-1-(3-acetamidophenyl)-2-propen-1-one
- N-[3-(3-DIMETHYLAMINO-1-OXO-2-PROPENYL)PHENYL]ACETAMIDE
- INDIP-010
- AKOS B035607
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
N-[3-(3-Dimethylaminoacryloyl)phenyl]acetamide
CAS:Controlled ProductApplications Intermediate in the preparation of Zaleplon
References Sanger, D., et al.: Eur. J. Pharmacol., 313, 35 (1996), Collins, J., et al.: J. Med. Chem., 41, 2858 (1998),Formula:C13H16N2O2Color and Shape:NeatMolecular weight:232.28N-{3-[(2E)-3-(dimethylamino)prop-2-enoyl]phenyl}acetamide
CAS:Formula:C13H16N2O2Molecular weight:232.283


