CymitQuimica logo

CAS 96605-65-1

:

N-[3-[3-(Dimethylamino)-1-oxo-2-propenyl]phenyl]-N-methylacetamide

Description:
N-[3-[3-(Dimethylamino)-1-oxo-2-propenyl]phenyl]-N-methylacetamide, identified by its CAS number 96605-65-1, is a synthetic organic compound characterized by its complex structure, which includes an acetamide functional group and a dimethylamino moiety. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential reactivity due to the presence of the carbonyl group. The dimethylamino group contributes to its basicity and potential for forming salts. The presence of the propenyl group suggests that it may participate in various chemical reactions, including Michael additions or polymerization processes. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its stability, reactivity, and solubility can vary based on environmental conditions such as pH and temperature. Overall, this compound's unique structural features position it as a candidate for further investigation in both chemical synthesis and biological applications.
Formula:C14H18N2O2
InChI:InChI=1S/C14H18N2O2/c1-11(17)16(4)13-7-5-6-12(10-13)14(18)8-9-15(2)3/h5-10H,1-4H3
InChI key:InChIKey=CWHTXVLCGAQQRA-UHFFFAOYSA-N
SMILES:C(C=CN(C)C)(=O)C1=CC(N(C(C)=O)C)=CC=C1
Synonyms:
  • N-[3-[3-(Dimethylamino)-1-oxo-2-propenyl]phenyl]-N-methylacetamide
  • Acetamide, N-[3-[3-(dimethylamino)-1-oxo-2-propenyl]phenyl]-N-methyl-
  • Acetamide, N-[3-[3-(dimethylamino)-1-oxo-2-propen-1-yl]phenyl]-N-methyl-
  • N-[3-[3-(Dimethylamino)-1-oxo-2-propen-1-yl]phenyl]-N-methylacetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.