CAS 96619-91-9

4-(Propylamino)-4-piperidinecarboxamide

Description:

4-(Propylamino)-4-piperidinecarboxamide, identified by its CAS number 96619-91-9, is a chemical compound characterized by its piperidine structure, which includes a piperidine ring substituted with a propylamino group and a carboxamide functional group. This compound typically exhibits properties associated with amides, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of the amide group. The propylamino substitution can influence its biological activity and pharmacological properties, making it of interest in medicinal chemistry. The compound may also display specific reactivity patterns typical of amines and amides, including nucleophilic behavior. Its molecular structure suggests potential applications in drug development, particularly in areas targeting central nervous system disorders, given the piperidine moiety's prevalence in various pharmaceuticals. However, detailed studies on its specific physical and chemical properties, such as melting point, boiling point, and spectral data, would be necessary to fully characterize its behavior and potential applications.

Formula: C₉H₁₉N₃O

InChI: InChI=1S/C9H19N3O/c1-2-5-12-9(8(10)13)3-6-11-7-4-9/h11-12H,2-7H2,1H3,(H2,10,13)

InChI key: InChIKey=KZMRRQMCXODLGO-UHFFFAOYSA-N

SMILES: N(CCC)C1(C(N)=O)CCNCC1

Synonyms:

• 4-Piperidinecarboxamide, 4-(propylamino)-
• 4-(Propylamino)-4-piperidinecarboxamide