CAS 96628-70-5
:4-Chloro-3-methoxypyridine
Description:
4-Chloro-3-methoxypyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chlorine atom at the 4-position and a methoxy group (-OCH3) at the 3-position contributes to its unique chemical properties. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its form. It is soluble in organic solvents and exhibits moderate polarity due to the electronegative chlorine and oxygen atoms. 4-Chloro-3-methoxypyridine is often utilized in pharmaceutical synthesis and as an intermediate in the production of various agrochemicals. Its reactivity is influenced by the electron-withdrawing nature of the chlorine atom, which can enhance nucleophilic substitution reactions. Additionally, the methoxy group can participate in various chemical transformations, making this compound valuable in synthetic organic chemistry. Safety precautions should be taken when handling this substance, as it may pose health risks if inhaled or ingested.
Formula:C6H6ClNO
InChI:InChI=1/C6H6ClNO/c1-9-6-4-8-3-2-5(6)7/h2-4H,1H3
SMILES:COc1cnccc1Cl
Synonyms:- Pyridine, 4-Chloro-3-Methoxy-
- 4-Chloro-3-methoxypyridine
- 4-chloro-3-methoxy-Pyridine
- 4-Chloro-3-methoxypyridine hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
