CymitQuimica logo

CAS 96643-92-4

:

3-(fluoromethyl)-3-hydroxy-5-{[hydroxy(phosphonooxy)phosphoryl]oxy}pentanoic acid

Description:
3-(Fluoromethyl)-3-hydroxy-5-{[hydroxy(phosphonooxy)phosphoryl]oxy}pentanoic acid, with CAS number 96643-92-4, is a complex organic compound characterized by its unique functional groups and structural features. This substance contains a fluoromethyl group, which imparts specific reactivity and potential biological activity, as well as multiple hydroxyl groups that enhance its solubility in polar solvents and may contribute to hydrogen bonding interactions. The presence of phosphono and phosphoryl groups suggests that it may exhibit properties relevant to biochemical processes, particularly in relation to phosphate metabolism or enzyme interactions. The pentanoic acid backbone indicates that it is a carboxylic acid, which can participate in acid-base reactions. Overall, this compound's structure suggests potential applications in pharmaceuticals or biochemistry, particularly in the development of inhibitors or modulators of enzymatic activity. Its stability, reactivity, and biological implications would depend on the specific conditions under which it is studied or utilized.
Formula:C6H13FO10P2
InChI:InChI=1/C6H13FO10P2/c7-4-6(10,3-5(8)9)1-2-16-19(14,15)17-18(11,12)13/h10H,1-4H2,(H,8,9)(H,14,15)(H2,11,12,13)
SMILES:C(COP(=O)(O)OP(=O)(O)O)C(CC(=O)O)(CF)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.