CymitQuimica logo

CAS 96651-85-3

:

2,3-dihydrospiro[indene-1,4'-piperidine] hydrochloride

Description:
2,3-Dihydrospiro[indene-1,4'-piperidine] hydrochloride is a chemical compound characterized by its unique spirocyclic structure, which combines an indene moiety with a piperidine ring. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it suitable for various applications in medicinal chemistry and pharmacology. The presence of the hydrochloride salt form enhances its stability and solubility. Its molecular structure suggests potential biological activity, particularly in the realm of neuropharmacology, where compounds with piperidine rings are often investigated for their effects on neurotransmitter systems. The compound's specific interactions and mechanisms of action would require further investigation through experimental studies. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as well as compliance with regulatory guidelines. Overall, 2,3-dihydrospiro[indene-1,4'-piperidine] hydrochloride represents an interesting target for research in drug development.
Formula:C13H17N・ClH
InChI:InChI=1S/C13H17N.ClH/c1-2-4-12-11(3-1)5-6-13(12)7-9-14-10-8-13;/h1-4,14H,5-10H2;1H
InChI key:ALQOOMOOZAZVBQ-UHFFFAOYSA-N
SMILES:C1CC2(CCNCC2)C3=CC=CC=C31.Cl
Found 5 products.