CymitQuimica logo

CAS 96681-85-5

:

3,6-Bis(2-hydroxyethyl)-2-pyrazinepropanoic acid

Description:
3,6-Bis(2-hydroxyethyl)-2-pyrazinepropanoic acid is a chemical compound characterized by its unique structure, which includes a pyrazine ring and two hydroxyethyl groups attached to a propanoic acid moiety. This compound is known for its potential applications in various fields, including pharmaceuticals and biochemistry, due to its ability to interact with biological systems. The presence of hydroxyl groups enhances its solubility in water and may contribute to its reactivity, making it a useful intermediate in organic synthesis. Additionally, the pyrazine ring can participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. The compound's properties, such as melting point, boiling point, and stability, can vary based on environmental conditions and the presence of other substances. Overall, 3,6-Bis(2-hydroxyethyl)-2-pyrazinepropanoic acid is a versatile compound with significant potential for research and industrial applications.
Formula:C11H16N2O4
InChI:InChI=1S/C11H16N2O4/c14-5-3-8-7-12-9(4-6-15)10(13-8)1-2-11(16)17/h7,14-15H,1-6H2,(H,16,17)
InChI key:InChIKey=LOAQLPWVJYSQKH-UHFFFAOYSA-N
SMILES:C(CC(O)=O)C=1C(CCO)=NC=C(CCO)N1
Synonyms:
  • Pyrazinepropanoic acid, 3,6-bis(2-hydroxyethyl)-
  • 3,6-Bis(2-hydroxyethyl)-2-pyrazinepropanoic acid
  • 3-(2-Carboxyethyl)-2,5-bis(2-hydroxyethyl)pyrazine
  • 2-Pyrazinepropanoic acid, 3,6-bis(2-hydroxyethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.