CymitQuimica logo

CAS 96685-53-9

:

(2Z)-2-[(5S)-5-{[tert-butyl(dimethyl)silyl]oxy}-2-methylidenecyclohexylidene]ethanol

Description:
The chemical substance with the name "(2Z)-2-[(5S)-5-{[tert-butyl(dimethyl)silyl]oxy}-2-methylidenecyclohexylidene]ethanol" and CAS number 96685-53-9 is a complex organic compound characterized by its unique structural features. It contains a cyclohexylidene moiety, which contributes to its cyclic structure, and a tert-butyl(dimethyl)silyl group that enhances its stability and solubility in organic solvents. The presence of the hydroxyl (-OH) group indicates that it is an alcohol, which may impart certain polar characteristics to the molecule. The stereochemistry is significant, as indicated by the (2Z) and (5S) descriptors, suggesting specific spatial arrangements that can influence the compound's reactivity and interactions with biological systems. This compound may be of interest in synthetic organic chemistry and materials science due to its potential applications in pharmaceuticals or as a building block in complex organic synthesis. Its properties, such as melting point, boiling point, and solubility, would need to be determined experimentally for practical applications.
Formula:C15H28O2Si
InChI:InChI=1/C15H28O2Si/c1-12-7-8-14(11-13(12)9-10-16)17-18(5,6)15(2,3)4/h9,14,16H,1,7-8,10-11H2,2-6H3/b13-9-/t14-/m0/s1
SMILES:C=C1CC[C@@H](C/C/1=C/CO)O[Si](C)(C)C(C)(C)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.