CAS 96693-86-6

2-Pentyl-4-propylthiazole

Description:

2-Pentyl-4-propylthiazole is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features a pentyl group and a propyl group attached to the thiazole ring, contributing to its hydrophobic nature. It is typically a colorless to pale yellow liquid with a distinctive odor, often associated with certain food flavors. The presence of the thiazole moiety imparts unique chemical properties, including potential reactivity in various organic reactions. 2-Pentyl-4-propylthiazole is primarily studied for its applications in flavoring and fragrance industries, as well as its potential biological activities. Its molecular structure allows for interactions with biological systems, making it of interest in research related to food science and chemistry. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, 2-Pentyl-4-propylthiazole exemplifies the diverse functionalities of thiazole derivatives in organic chemistry.

Formula: C₁₁H₁₉NS

InChI: InChI=1S/C11H19NS/c1-3-5-6-8-11-12-10(7-4-2)9-13-11/h9H,3-8H2,1-2H3

InChI key: InChIKey=HZWDDRTWBCHNGJ-UHFFFAOYSA-N

SMILES: C(CCCC)C1=NC(CCC)=CS1

Synonyms:

• 2-Pentyl-4-propylthiazole
• Thiazole, 2-pentyl-4-propyl-
• 2-Pentyl-4-propyl-1,3-thiazole