CAS 96695-58-8
:(3S,4R)-4-hydroxy-8-methoxy-3-methyl-3,4-dihydrotetraphene-1,7,12(2H)-trione
Description:
(3S,4R)-4-hydroxy-8-methoxy-3-methyl-3,4-dihydrotetraphene-1,7,12(2H)-trione, with the CAS number 96695-58-8, is a complex organic compound characterized by its unique polycyclic structure, which includes multiple fused aromatic rings. This compound features specific stereochemistry, indicated by the (3S,4R) configuration, which plays a crucial role in its chemical behavior and potential biological activity. The presence of hydroxyl (-OH) and methoxy (-OCH3) functional groups suggests that it may exhibit hydrogen bonding and other interactions that could influence its solubility and reactivity. The methyl group contributes to the overall hydrophobic character of the molecule. As a dihydrotetraphene derivative, it may possess interesting optical properties, making it a candidate for applications in materials science or organic electronics. Additionally, the presence of multiple carbonyl groups (as indicated by the trione designation) may enhance its reactivity in various chemical transformations. Overall, this compound's structural features suggest potential utility in research and development within organic chemistry and related fields.
Formula:C20H16O5
InChI:InChI=1/C20H16O5/c1-9-8-13(21)15-11(18(9)22)6-7-12-17(15)20(24)10-4-3-5-14(25-2)16(10)19(12)23/h3-7,9,18,22H,8H2,1-2H3/t9-,18+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Rubiginone A2
CAS:Rubiginone A2 is an antibiotic compound, which is derived from the bacterial species that belong to the genus *Streptomyces*. This compound is characterized by its potent ability to inhibit bacterial growth through the disruption of essential cellular processes. The mode of action of Rubiginone A2 involves inhibition of bacterial DNA, RNA, and protein synthesis, effectively halting the growth and proliferation of susceptible species. Research indicates that it interacts specifically with key molecular targets within the microbial cell, leading to cellular dysfunction and eventual cell death.
Formula:C20H16O5Purity:Min. 95%Molecular weight:336.30 g/mol
