CAS 96722-49-5

Methyl 2-chloro-2-[2-(3-methylphenyl)hydrazinylidene]acetate

Description:

Methyl 2-chloro-2-[2-(3-methylphenyl)hydrazinylidene]acetate, with the CAS number 96722-49-5, is an organic compound characterized by its complex structure, which includes a methyl ester group, a chloro substituent, and a hydrazine derivative. This compound typically exhibits properties associated with both hydrazine and ester functionalities, making it potentially reactive in various chemical environments. It may participate in nucleophilic substitution reactions due to the presence of the chloro group, while the hydrazine moiety can engage in condensation reactions. The presence of the aromatic 3-methylphenyl group suggests that the compound may exhibit some degree of hydrophobicity, influencing its solubility in organic solvents. Additionally, the compound's structure may confer biological activity, making it of interest in medicinal chemistry. However, specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable databases for precise applications and safety assessments.

Formula: C₁₀H₁₁ClN₂O₂

InChI: InChI=1S/C10H11ClN2O2/c1-7-4-3-5-8(6-7)12-13-9(11)10(14)15-2/h3-6,12H,1-2H3

InChI key: InChIKey=SEEFAJDXOUHFBC-UHFFFAOYSA-N

SMILES: N(N=C(C(OC)=O)Cl)C1=CC(C)=CC=C1

Synonyms:

• Acetic acid, chloro[(3-methylphenyl)hydrazono]-, methyl ester
• Acetic acid, 2-chloro-2-[2-(3-methylphenyl)hydrazinylidene]-, methyl ester
• Methyl 2-chloro-2-[2-(3-methylphenyl)hydrazinylidene]acetate