CAS 96722-55-3

ethyl (2Z)-chloro[2-(4-phenoxyphenyl)hydrazinylidene]ethanoate

Description:

Ethyl (2Z)-chloro[2-(4-phenoxyphenyl)hydrazinylidene]ethanoate, identified by its CAS number 96722-55-3, is a chemical compound characterized by its complex structure, which includes an ethyl ester functional group and a hydrazone moiety. This compound features a chloro substituent and a phenoxyphenyl group, contributing to its potential reactivity and biological activity. The presence of the hydrazinylidene group suggests that it may participate in various chemical reactions, including condensation and substitution reactions. Its structural characteristics may impart specific properties such as solubility in organic solvents and potential interactions with biological targets, making it of interest in medicinal chemistry and material science. Additionally, the compound's stability, reactivity, and potential applications would depend on the specific conditions under which it is used, including solvent choice, temperature, and the presence of other reagents. Overall, ethyl (2Z)-chloro[2-(4-phenoxyphenyl)hydrazinylidene]ethanoate represents a unique chemical entity with potential applications in various fields of research.

Formula: C₁₆H₁₅ClN₂O₃

InChI: InChI=1/C16H15ClN2O3/c1-2-21-16(20)15(17)19-18-12-8-10-14(11-9-12)22-13-6-4-3-5-7-13/h3-11,18H,2H2,1H3/b19-15-

SMILES: CCOC(=O)/C(=N/Nc1ccc(cc1)Oc1ccccc1)/Cl

ethyl (2Z)-2-chloro-2-[2-(4-phenoxyphenyl)hydrazin-1-ylidene]acetate

CAS: 96722-55-3

Formula: C₁₆H₁₅ClN₂O₃

Purity: 95.0%

Molecular weight: 318.76

Ref: 10-F525398