CAS 96760-69-9

N-(4-{2-[(4-{2-[(2-aminoethyl)amino]-2-oxoethyl}phenyl)amino]-2-oxoethyl}phenyl)adenosine

Description:

N-(4-{2-[(4-{2-[(2-aminoethyl)amino]-2-oxoethyl}phenyl)amino]-2-oxoethyl}phenyl)adenosine, with the CAS number 96760-69-9, is a synthetic compound that belongs to the class of nucleoside analogs. This substance is characterized by its complex structure, which includes an adenosine moiety linked to a phenyl group that is further substituted with amino and oxoethyl groups. The presence of multiple functional groups, such as amino and carbonyl, suggests potential for various biological interactions, possibly influencing its pharmacological properties. The compound may exhibit properties such as solubility in polar solvents, and its structure indicates potential for binding to biological targets, which could be relevant in medicinal chemistry. Its design suggests applications in research, particularly in studies related to nucleoside metabolism or as a potential therapeutic agent. However, specific biological activities, toxicity, and pharmacokinetics would require further investigation to fully understand its implications in a biological context.

Formula: C₂₈H₃₂N₈O₆

InChI: InChI=1/C28H32N8O6/c29-9-10-30-21(38)11-16-1-5-18(6-2-16)34-22(39)12-17-3-7-19(8-4-17)35-26-23-27(32-14-31-26)36(15-33-23)28-25(41)24(40)20(13-37)42-28/h1-8,14-15,20,24-25,28,37,40-41H,9-13,29H2,(H,30,38)(H,34,39)(H,31,32,35)/t20-,24-,25-,28-/m1/s1

SMILES: c1cc(ccc1CC(=NCCN)O)NC(=O)Cc1ccc(cc1)Nc1c2c(ncn1)n(cn2)[C@H]1[C@@H]([C@@H]([C@@H](CO)O1)O)O

Adenosine amine congener

CAS: 96760-69-9

Adenosine amine congener

Purity: ≥95%

Molecular weight: 576.6g/mol

Ref: 54-BUP03069

Adenosine amine congener

CAS: 96760-69-9

Adenosine amine congener (ADAC) (ADAC) is an agonist of selective A1 adenosine receptor,.

Formula: C₂₈H₃₂N₈O₆

Purity: 97.86%

Color and Shape: Solid

Molecular weight: 576.6

Ref: TM-T7683