
CAS 96782-98-8
:2H-1,2,4-Benzothiadiazine-7-sulfonamide, 6-chloro-3,4-dihydro-3-(phenylmethyl)-, 1,1-dioxide, (-)-
Description:
2H-1,2,4-Benzothiadiazine-7-sulfonamide, 6-chloro-3,4-dihydro-3-(phenylmethyl)-, 1,1-dioxide, commonly referred to by its CAS number 96782-98-8, is a chemical compound characterized by its complex structure that includes a benzothiadiazine core. This compound features a sulfonamide group, which is known for its biological activity, particularly in medicinal chemistry. The presence of a chlorine atom and a phenylmethyl group contributes to its unique properties, potentially influencing its solubility and reactivity. As a sulfonamide derivative, it may exhibit antibacterial or diuretic effects, although specific biological activities would depend on its interactions at the molecular level. The compound is typically solid at room temperature and may be used in various applications, including pharmaceuticals. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this compound represents a class of chemicals with significant potential in therapeutic applications, warranting further investigation into its properties and uses.
Formula:C14H14ClN3O4S2
InChI:InChI=1/C14H14ClN3O4S2/c15-10-7-11-13(8-12(10)23(16,19)20)24(21,22)18-14(17-11)6-9-4-2-1-3-5-9/h1-5,7-8,14,17-18H,6H2,(H2,16,19,20)
InChI key:InChIKey=BWSSMIJUDVUASQ-UHFFFAOYNA-N
SMILES:O=S1(=O)C=2C(NC(CC3=CC=CC=C3)N1)=CC(Cl)=C(S(N)(=O)=O)C2
Synonyms:- 2H-1,2,4-Benzothiadiazine-7-sulfonamide, 6-chloro-3,4-dihydro-3-(phenylmethyl)-, 1,1-dioxide, (-)-
- (-)-Benzylhydrochlorothiazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2H-1,2,4-Benzothiadiazine-7-sulfonamide, 6-chloro-3,4-dihydro-3-(phenylmethyl)-, 1,1-dioxide, (-)-
CAS:Formula:C14H14ClN3O4S2Molecular weight:387.8617
