CAS 96795-90-3

(6S,10bR)-6-[4-(methylsulfanyl)phenyl]-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline perchlorate (1:1)

Description:

The chemical substance known as "(6S,10bR)-6-[4-(methylsulfanyl)phenyl]-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline perchlorate (1:1)" with CAS number 96795-90-3 is a complex organic compound characterized by its unique structural features, including a hexahydropyrroloisoquinoline framework. This compound contains a methylsulfanyl group attached to a phenyl ring, which contributes to its potential biological activity and solubility properties. The presence of the perchlorate ion indicates that it is a salt form, which may influence its stability and reactivity. The stereochemistry, denoted by the (6S,10bR) configuration, suggests specific spatial arrangements of atoms that can affect the compound's interactions with biological targets. Such compounds are often studied for their pharmacological properties, and their intricate structures may lead to diverse applications in medicinal chemistry. Overall, the characteristics of this substance highlight its potential significance in research and development within the field of organic and medicinal chemistry.

Formula: C₁₉H₂₂ClNO₄S

InChI: InChI=1/C19H21NS.ClHO4/c1-21-15-10-8-14(9-11-15)18-13-20-12-4-7-19(20)17-6-3-2-5-16(17)18;2-1(3,4)5/h2-3,5-6,8-11,18-19H,4,7,12-13H2,1H3;(H,2,3,4,5)/t18-,19+;/m0./s1

MCN-5652 perchlorate

CAS: 96795-90-3

MCN-5652 perchlorate is a serotonin uptake inhibitor.

Formula: C₁₉H₂₂ClNO₄S

Color and Shape: Solid

Molecular weight: 395.9

Ref: TM-T68210