CAS 96826-17-4

2,3-Bis(2-fluoro-4-hydroxyphenyl)-2,3-dimethylbutane

Description:

2,3-Bis(2-fluoro-4-hydroxyphenyl)-2,3-dimethylbutane, with the CAS number 96826-17-4, is an organic compound characterized by its complex structure featuring two fluorinated phenolic groups attached to a dimethylbutane backbone. This compound is notable for its potential applications in pharmaceuticals and materials science due to the presence of both fluorine and hydroxyl functional groups, which can enhance its reactivity and solubility properties. The fluorine atoms contribute to increased lipophilicity and can influence the compound's biological activity, while the hydroxyl groups may participate in hydrogen bonding, affecting its interactions with other molecules. Additionally, the steric hindrance introduced by the dimethyl groups can impact the compound's conformation and stability. Overall, this compound exemplifies the intricate balance of functionalization and structural features that can be tailored for specific applications in chemical research and development.

Formula: C₁₈H₂₀F₂O₂

InChI: InChI=1/C18H20F2O2/c1-17(2,13-7-5-11(21)9-15(13)19)18(3,4)14-8-6-12(22)10-16(14)20/h5-10,21-22H,1-4H3

SMILES: CC(C)(c1ccc(cc1F)O)C(C)(C)c1ccc(cc1F)O

Synonyms:

• D-18954
• 4,4'-(2,3-Dimethylbutane-2,3-Diyl)Bis(3-Fluorophenol)