
CAS 96826-28-7
:3-Chloro-5-methoxy-α,α-dimethylbenzenemethanol
Description:
3-Chloro-5-methoxy-α,α-dimethylbenzenemethanol, with the CAS number 96826-28-7, is an organic compound characterized by its complex structure, which includes a chlorinated aromatic ring and a methanol functional group. This compound features a chlorine atom and a methoxy group (-OCH3) attached to a dimethyl-substituted benzene ring, contributing to its unique chemical properties. The presence of the chlorine atom typically enhances the compound's reactivity, while the methoxy group can influence its solubility and polarity. As a benzenemethanol derivative, it may exhibit properties such as potential biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. The compound's molecular structure suggests it may participate in hydrogen bonding due to the hydroxyl (-OH) group, affecting its interactions in different environments. Overall, 3-Chloro-5-methoxy-α,α-dimethylbenzenemethanol is a compound with distinctive characteristics that can be explored for various applications in chemical research and development.
Formula:C10H13ClO2
InChI:InChI=1S/C10H13ClO2/c1-10(2,12)7-4-8(11)6-9(5-7)13-3/h4-6,12H,1-3H3
InChI key:InChIKey=KRNLZIFWRVVURA-UHFFFAOYSA-N
SMILES:C(C)(C)(O)C1=CC(OC)=CC(Cl)=C1
Synonyms:- 2-(3-Chloro-5-methoxyphenyl)propan-2-ol
- Benzenemethanol, 3-chloro-5-methoxy-α,α-dimethyl-
- 3-Chloro-5-methoxy-α,α-dimethylbenzenemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.