
CAS 96847-54-0
:(1S,2R)-Milnacipran
Description:
(1S,2R)-Milnacipran is a chemical compound primarily recognized as a serotonin-norepinephrine reuptake inhibitor (SNRI), commonly used in the treatment of fibromyalgia and major depressive disorder. It is characterized by its chiral centers, which contribute to its specific stereochemistry, influencing its pharmacological activity. The compound has a molecular formula that includes carbon, hydrogen, nitrogen, and oxygen atoms, reflecting its organic nature. (1S,2R)-Milnacipran exhibits moderate lipophilicity, allowing it to cross biological membranes effectively, which is crucial for its therapeutic effects. Its mechanism of action involves the inhibition of the reuptake of serotonin and norepinephrine in the synaptic cleft, enhancing neurotransmitter availability and contributing to mood regulation and pain relief. The compound is typically administered orally and has a relatively long half-life, which supports once-daily dosing in clinical settings. As with many pharmaceuticals, it may have side effects, and its use should be monitored by healthcare professionals to ensure safety and efficacy.
Formula:C15H22N2O
InChI:InChI=1S/C15H22N2O/c1-3-17(4-2)14(18)15(10-13(15)11-16)12-8-6-5-7-9-12/h5-9,13H,3-4,10-11,16H2,1-2H3/t13-,15+/m0/s1
InChI key:InChIKey=GJJFMKBJSRMPLA-DZGCQCFKSA-N
SMILES:C(N(CC)CC)(=O)[C@@]1([C@H](CN)C1)C2=CC=CC=C2
Synonyms:- (1S,2R)-Milnacipran
- (1S,2R)-2-(Aminomethyl)-N,N-diethyl-1-phenylcyclopropanecarboxamide
- Cyclopropanecarboxamide, 2-(aminomethyl)-N,N-diethyl-1-phenyl-, (1S-cis)-
- Cyclopropanecarboxamide, 2-(aminomethyl)-N,N-diethyl-1-phenyl-, (1S,2R)-
- F 2695
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
