CAS 96849-38-6
:phi-27 rat
Description:
"Phi-27 rat" is a chemical substance identified by the CAS number 96849-38-6, which is known for its role in research, particularly in the field of pharmacology and biochemistry. While specific details about its characteristics may not be widely documented, substances with similar nomenclature often serve as experimental tools in studies involving biological systems, potentially acting as ligands or modulators in various biochemical pathways. Typically, such compounds may exhibit properties like solubility in organic solvents, specific binding affinities to target proteins, and varying degrees of stability under different environmental conditions. The precise mechanism of action, toxicity, and pharmacokinetics would depend on its molecular structure and functional groups. Researchers often utilize such compounds to explore their effects on cellular processes, signaling pathways, or to develop therapeutic agents. For detailed characteristics, including physical and chemical properties, safety data, and specific applications, consulting specialized databases or scientific literature is recommended.
Formula:C6H14N2O
InChI:InChI=1/C6H14N2O/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H2,8,9)
SMILES:CCC(C)C(C(=N)O)N
Synonyms:- H-His-Ala-Asp-Gly-Val-Phe-Thr-Ser-Asp-Tyr-Ser-Arg-Leu-Leu-Gly-Gln-Ile-Ser-Ala-Lys-Lys-Tyr-Leu-Glu-Ser-Leu-Ile-NH2
- Isoleucinamide
- PHI-27 (rat)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.