CAS 96860-23-0

N,N-dimethyl-2-{[2-(1-pyridin-2-ylethylidene)hydrazino]carbonothioyl}hydrazinecarbothioamide

Description:

N,N-Dimethyl-2-{[2-(1-pyridin-2-ylethylidene)hydrazino]carbonothioyl}hydrazinecarbothioamide is a complex organic compound characterized by its hydrazine and thioamide functional groups. This substance features a hydrazine backbone, which is known for its reactivity and ability to form various derivatives. The presence of a pyridine ring contributes to its aromatic properties, potentially influencing its electronic characteristics and solubility. The compound's thioamide group enhances its reactivity, particularly in nucleophilic substitution reactions. Additionally, the dimethyl substitution on the nitrogen atoms can affect the steric hindrance and overall stability of the molecule. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structure suggests potential applications in various fields, including agrochemicals and materials science. However, specific properties such as solubility, melting point, and reactivity would require empirical data for precise characterization.

Formula: C₁₁H₁₆N₆S₂

InChI: InChI=1/C11H16N6S2/c1-8(9-6-4-5-7-12-9)13-14-10(18)15-16-11(19)17(2)3/h4-7H,1-3H3,(H,16,19)(H2,14,15,18)

A 1110U

CAS: 96860-23-0

A 1110U is an inactivator of herpes simplex virus ribonucloetide reductases.

Formula: C₁₁H₁₆N₆S₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 296.41

Ref: TM-T26402