CAS 96887-18-2

5,7-dihydroxy-3,6,8-trimethoxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one

Description:

5,7-Dihydroxy-3,6,8-trimethoxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one, with the CAS number 96887-18-2, is a flavonoid compound characterized by its complex structure, which includes multiple methoxy groups and hydroxyl substituents. This compound belongs to the class of flavones, which are known for their diverse biological activities, including antioxidant, anti-inflammatory, and potential anticancer properties. The presence of multiple methoxy groups enhances its lipophilicity, potentially influencing its bioavailability and interaction with biological systems. The hydroxyl groups contribute to its ability to form hydrogen bonds, which may enhance its solubility in polar solvents and its reactivity in various chemical environments. Additionally, the chromenone core structure is significant for its role in various biochemical pathways. Overall, this compound's unique structural features suggest it may have valuable applications in pharmacology and medicinal chemistry, warranting further investigation into its therapeutic potential.

Formula: C₂₁H₂₂O₁₀

InChI: InChI=1/C21H22O10/c1-25-10-7-9(8-11(26-2)17(10)27-3)16-20(29-5)14(23)12-13(22)19(28-4)15(24)21(30-6)18(12)31-16/h7-8,22,24H,1-6H3

SMILES: COc1cc(cc(c1OC)OC)c1c(c(=O)c2c(c(c(c(c2o1)OC)O)OC)O)OC

Synonyms:

• 4H-1-benzopyran-4-one, 5,7-dihydroxy-3,6,8-trimethoxy-2-(3,4,5-trimethoxyphenyl)-

5,7-dihydroxy 3,3',4',5',6,8-hexamethoxyflavone

CAS: 96887-18-2

Oxygen-heterocyclic compound

Formula: C₂₁H₂₂O₁₀

Purity: ≥ 95.0 % (HPLC)

Color and Shape: Powder

Molecular weight: 434.4

Ref: 5G-82522