CAS 96898-76-9

2-Chloro-N-hydroxy-4-nitrobenzenecarboximidamide

Description:

2-Chloro-N-hydroxy-4-nitrobenzenecarboximidamide, with the CAS number 96898-76-9, is a chemical compound characterized by its complex structure, which includes a chloro group, a nitro group, and a hydroxylamine functional group attached to a benzene ring. This compound typically exhibits properties associated with both aromatic and amine functionalities, making it potentially reactive in various chemical environments. The presence of the nitro group suggests that it may participate in electrophilic substitution reactions, while the hydroxylamine moiety can engage in nucleophilic reactions. The chloro substituent can also serve as a leaving group in certain reactions, enhancing its reactivity profile. In terms of solubility, compounds of this nature are often soluble in polar solvents due to the presence of functional groups capable of hydrogen bonding. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical research. However, specific safety and handling guidelines should be followed due to the potential toxicity associated with nitro and chloro compounds.

Formula: C₇H₆ClN₃O₃

InChI: InChI=1S/C7H6ClN3O3/c8-6-3-4(11(13)14)1-2-5(6)7(9)10-12/h1-3,12H,(H2,9,10)

InChI key: InChIKey=NSFQGSYKNYKJCB-UHFFFAOYSA-N

SMILES: C(NO)(=N)C1=C(Cl)C=C(N(=O)=O)C=C1

Synonyms:

• 2-Chloro-N′-hydroxy-4-nitrobenzamidine
• 2-Chloro-N-hydroxy-4-nitrobenzenecarboximidamide
• 2-Chloro-4-nitrobenzamidoxime
• Benzenecarboximidamide, 2-chloro-N-hydroxy-4-nitro-
• 2-Chloro-N′-hydroxy-4-nitrobenzene-1-carboximidamide

2-Chloro-N'-hydroxy-4-nitrobenzamidine

CAS: 96898-76-9

2-Chloro-N'-hydroxy-4-nitrobenzamidine

Purity: 95%

Molecular weight: 215.6g/mol

Ref: 54-OR1003655