CymitQuimica logo

CAS 96911-75-0

:

6-(4-Pyridinyl)imidazo[2,1-b]thiazole

Description:
6-(4-Pyridinyl)imidazo[2,1-b]thiazole is a heterocyclic compound characterized by its unique structure, which combines an imidazole ring with a thiazole moiety and a pyridine substituent. This compound typically exhibits properties such as moderate solubility in polar organic solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of nitrogen and sulfur atoms in its structure contributes to its chemical reactivity and potential interactions with biological targets. It may exhibit fluorescence properties, which can be useful in various applications, including biological imaging. Additionally, compounds of this type are often investigated for their pharmacological activities, including antimicrobial, anticancer, and anti-inflammatory effects. The specific characteristics, such as melting point, boiling point, and spectral data, can vary based on the purity and form of the compound. Overall, 6-(4-Pyridinyl)imidazo[2,1-b]thiazole represents a class of compounds that are valuable in research and development within the fields of chemistry and pharmacology.
Formula:C10H7N3S
InChI:InChI=1S/C10H7N3S/c1-3-11-4-2-8(1)9-7-13-5-6-14-10(13)12-9/h1-7H
InChI key:InChIKey=NLBFMECAIAFASS-UHFFFAOYSA-N
SMILES:C1(=CN2C(=N1)SC=C2)C=3C=CN=CC3
Synonyms:
  • 6-(4-Pyridinyl)imidazo[2,1-b]thiazole
  • Imidazo[2,1-b]thiazole, 6-(4-pyridinyl)-
  • NSC 641288
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.