CAS 96922-64-4

Carbamic acid, [2-[(3-fluoro-1-methyl-2-oxopropyl)amino]-2-oxo-1-(phenylmethyl)ethyl]-, phenylmethyl ester

Description:

Carbamic acid, with the specific name "2-[(3-fluoro-1-methyl-2-oxopropyl)amino]-2-oxo-1-(phenylmethyl)ethyl]-, phenylmethyl ester," is a complex organic compound characterized by its carbamate functional group. This substance features a phenylmethyl ester moiety, which contributes to its lipophilicity and potential biological activity. The presence of a fluorinated alkyl group enhances its chemical stability and may influence its pharmacokinetic properties. The compound's structure suggests it may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. Its molecular framework includes multiple functional groups, which can participate in various chemical reactions, such as hydrolysis or nucleophilic substitution. The compound's CAS number, 96922-64-4, allows for precise identification in chemical databases. While detailed physical and chemical properties such as solubility, melting point, and boiling point are not specified here, they are essential for understanding the compound's behavior in different environments and applications. Overall, this compound's unique structure positions it as a candidate for further research in pharmaceutical development.

Formula: C₂₁H₂₃FN₂O₄

InChI: InChI=1S/C21H23FN2O4/c1-15(19(25)13-22)23-20(26)18(12-16-8-4-2-5-9-16)24-21(27)28-14-17-10-6-3-7-11-17/h2-11,15,18H,12-14H2,1H3,(H,23,26)(H,24,27)

InChI key: InChIKey=ASXVEBPEZMSPHB-UHFFFAOYSA-N

SMILES: C(CC1=CC=CC=C1)(C(NC(C(CF)=O)C)=O)NC(OCC2=CC=CC=C2)=O

Synonyms:

• Carbamic acid, [2-[(3-fluoro-1-methyl-2-oxopropyl)amino]-2-oxo-1-(phenylmethyl)ethyl]-, phenylmethyl ester

Mdl 201053

CAS: 96922-64-4

Mdl 201053 is a biochemical.

Formula: C₂₁H₂₃FN₂O₄

Color and Shape: Solid

Molecular weight: 386.42

Ref: TM-T33262