CAS 96938-27-1

6,8-Dibromo-2-methyl-4-quinolinamine

Description:

6,8-Dibromo-2-methyl-4-quinolinamine is an organic compound characterized by its quinoline structure, which features a bicyclic aromatic system. This compound contains two bromine atoms at the 6 and 8 positions, contributing to its reactivity and potential applications in various chemical reactions. The presence of a methyl group at the 2 position and an amino group at the 4 position enhances its solubility and biological activity. Typically, compounds like this may exhibit properties such as antimicrobial or antitumor activity, making them of interest in medicinal chemistry. The molecular structure allows for various substitution reactions, which can be exploited in synthetic organic chemistry. Additionally, the bromine substituents can facilitate further functionalization, enabling the development of derivatives with tailored properties. As with many brominated compounds, considerations regarding environmental impact and toxicity are important, particularly in terms of their persistence and bioaccumulation potential. Overall, 6,8-Dibromo-2-methyl-4-quinolinamine represents a versatile scaffold for further chemical exploration and application.

Formula: C₁₀H₈Br₂N₂

InChI: InChI=1S/C10H8Br2N2/c1-5-2-9(13)7-3-6(11)4-8(12)10(7)14-5/h2-4H,1H3,(H2,13,14)

InChI key: InChIKey=IXZLFYGREGHTRA-UHFFFAOYSA-N

SMILES: NC=1C2=C(N=C(C)C1)C(Br)=CC(Br)=C2

Synonyms:

• 6,8-Dibromo-2-methyl-4-quinolinamine
• 4-Quinolinamine, 6,8-dibromo-2-methyl-
• 4-Amino-6,8-dibromo-2-methylquinoline