CAS 96990-19-1
:Momordin IIc
Description:
Momordin IIc is a triterpenoid saponin derived from the fruit of the Momordica charantia, commonly known as bitter melon. This compound is characterized by its complex structure, which includes a steroid-like backbone and sugar moieties that contribute to its biological activity. Momordin IIc exhibits various pharmacological properties, including anti-inflammatory, anti-diabetic, and anti-cancer effects, making it a subject of interest in medicinal chemistry and pharmacology. Its mechanism of action is thought to involve modulation of cellular pathways and interactions with specific receptors, although detailed studies are ongoing to fully elucidate these mechanisms. Additionally, Momordin IIc is known for its potential to influence glucose metabolism, which has implications for diabetes management. As a natural product, it is often explored for its therapeutic potential while also being assessed for safety and efficacy in various biological systems. Overall, Momordin IIc represents a significant compound in the study of natural products and their applications in health and disease.
Formula:C47H74O18
InChI:InChI=1S/C47H74O18/c1-42(2)14-16-47(41(59)65-39-32(54)30(52)29(51)24(19-48)61-39)17-15-45(6)21(22(47)18-42)8-9-26-44(5)12-11-27(43(3,4)25(44)10-13-46(26,45)7)62-40-34(56)35(33(55)36(64-40)37(57)58)63-38-31(53)28(50)23(49)20-60-38/h8,22-36,38-40,48-56H,9-20H2,1-7H3,(H,57,58)/t22-,23+,24+,25-,26+,27-,28-,29+,30-,31+,32+,33-,34+,35-,36-,38-,39-,40+,44-,45+,46+,47-/m0/s1
InChI key:InChIKey=BAJBCZHVQXVBMJ-BJEVZSKZSA-N
SMILES:C(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)(=O)[C@]23[C@](C=4[C@@](C)(CC2)[C@@]5(C)[C@](CC4)([C@]6(C)[C@@](CC5)(C(C)(C)[C@@H](O[C@H]7[C@H](O)[C@@H](O[C@H]8[C@H](O)[C@@H](O)[C@H](O)CO8)[C@H](O)[C@@H](C(O)=O)O7)CC6)[H])[H])(CC(C)(C)CC3)[H]
Synonyms:- (3β)-28-(β-D-Glucopyranosyloxy)-28-oxoolean-12-en-3-yl 3-O-β-D-xylopyranosyl-β-D-glucopyranosiduronic acid
- Oleanane, β-D-glucopyranosiduronic acid deriv.
- Quinoside D
- β-D-Glucopyranosiduronic acid, (3β)-28-(β-D-glucopyranosyloxy)-28-oxoolean-12-en-3-yl 3-O-β-D-xylopyranosyl-
- Momordin IIc
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Momordin iic
CAS:Momordin IIC is a bioactive compound, classified as a triterpenoid saponin, which is derived from plants in the family Cucurbitaceae, most notably from Momordica charantia, commonly known as bitter melon. The mode of action of Momordin IIC involves the inhibition of cell proliferation and induction of apoptosis through the modulation of various signaling pathways, including the activation of caspases and alteration of mitochondrial membrane potential. Its molecular interactions lead to the suppression of tumor growth and exhibit potent anti-inflammatory effects.
Formula:C47H74O18Purity:Min. 95%Molecular weight:927.1 g/mol



