CAS 97-51-8
:5-Nitrosalicylaldehyde
Description:
5-Nitrosalicylaldehyde, with the CAS number 97-51-8, is an organic compound characterized by its aromatic structure, which includes a nitro group and an aldehyde functional group. It is a derivative of salicylaldehyde, where a nitroso group is substituted at the 5-position of the aromatic ring. This compound typically appears as a yellow to orange crystalline solid and is known for its potential applications in organic synthesis and as a reagent in various chemical reactions. It exhibits properties such as solubility in organic solvents and moderate stability under standard conditions. The presence of both the nitro and aldehyde groups contributes to its reactivity, making it useful in the synthesis of more complex molecules. Additionally, 5-Nitrosalicylaldehyde can participate in various chemical transformations, including condensation reactions and coordination with metal ions, which may enhance its utility in coordination chemistry and catalysis. Safety precautions should be observed when handling this compound due to its potential toxicity and reactivity.
Formula:C7H5NO4
InChI:InChI=1S/C7H5NO4/c9-4-5-3-6(8(11)12)1-2-7(5)10/h1-4,10H
InChI key:InChIKey=IHFRMUGEILMHNU-UHFFFAOYSA-N
SMILES:C(=O)C1=CC(N(=O)=O)=CC=C1O
Synonyms:- 2-Formyl-4-Nitrophenolate
- 2-Formyl-4-nitrophenol
- 2-Hydroxy-5-nitrobenzaldehyde
- 2-Hydroxy-5-nitrobenzaldehye
- 5-Nitro-2-hydroxybenzaldehyde
- 5-Nitrosalicilaldehido
- 5-Nitrosalicylaladhyde
- 5-Nitrosalicylaldehyd
- 5-Nitrososalicylaldehyde
- 5Nsa
- 6-Hydroxy-3-nitrobenzaldehyde
- Benzaldehyde, 2-hydroxy-5-nitro-
- Nsc 881
- Nsc 97387
- Salicylaldehyde, 5-nitro-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
5-Nitrosalicylaldehyde
CAS:Formula:C7H5NO4Purity:>97.0%(GC)(T)Color and Shape:White to Yellow to Orange powder to crystalMolecular weight:167.122-Hydroxy-5-nitrobenzaldehyde, 98%
CAS:2-Hydroxy-5-nitrobenzaldehyde is used in the synthetic preparation of coumarin (C755380), an pharmaceutic aid that is found in tonka beans, lavender oil, woodruff, sweet clover. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentatioFormula:C7H5NO4Purity:98%Color and Shape:Pale yellow to yellow to orange, PowderMolecular weight:167.122-Hydroxy-5-Nitrobenzaldehyde
CAS:Formula:C7H5NO4Purity:96%Color and Shape:SolidMolecular weight:167.11895-Nitrosalicylaldehyde
CAS:Formula:C7H5NO4Purity:≥ 98.0%Color and Shape:Yellow to orange or brown crystals or powderMolecular weight:167.122-Hydroxy-5-nitrobenzaldehyde
CAS:2-Hydroxy-5-nitrobenzaldehydeFormula:C7H5NO4Purity:≥95%Color and Shape: yellow powderMolecular weight:167.12g/mol2-Hydroxy-5-nitrobenzaldehyde
CAS:Formula:C7H5NO4Purity:98.0%Color and Shape:Solid, Crystalline Powder or PowderMolecular weight:167.125-Nitrosalicylaldehyde
CAS:5-Nitrosalicylaldehyde is a powerful inhibitor of bacterial growth. It has been shown to inhibit the growth of gram-positive bacteria such as Staphylococcus aureus and Streptococcus pyogenes, but not gram-negative bacteria such as Escherichia coli. 5-Nitrosalicylaldehyde is an antimicrobial agent that has been shown to bind to the active site of some enzymes, including bacterial DNA gyrase and human liver microsomes. The binding prevents the enzyme from functioning and leads to cell death. 5-Nitrosalicylaldehyde coordinates with sodium ions in the active site, forming strong hydrogen bonding interactions. This interaction stabilizes the transition state for the reaction and prevents it from happening, thereby inhibiting its function.
Formula:C7H5NO4Purity:Min. 95%Color and Shape:Yellow PowderMolecular weight:167.12 g/mol









