CAS 97005-76-0

4'-methoxyflavanone

Description:

4'-Methoxyflavanone, with the CAS number 97005-76-0, is a flavonoid compound characterized by its flavanone backbone, which consists of a 15-carbon skeleton typically arranged in a C6-C3-C6 configuration. This compound features a methoxy group (-OCH3) at the 4' position of the aromatic B-ring, which influences its solubility and biological activity. Flavonoids, including 4'-methoxyflavanone, are known for their antioxidant properties, which can help neutralize free radicals and reduce oxidative stress in biological systems. Additionally, this compound may exhibit various pharmacological activities, such as anti-inflammatory, antimicrobial, and anticancer effects, although specific studies on 4'-methoxyflavanone may be limited. Its structural characteristics contribute to its potential interactions with biological targets, making it a subject of interest in medicinal chemistry and natural product research. As with many flavonoids, its properties can be influenced by factors such as concentration, environment, and the presence of other compounds.

Formula: C₁₆H₁₄O₃

InChI: InChI=1/C16H14O3/c1-18-12-8-6-11(7-9-12)16-10-14(17)13-4-2-3-5-15(13)19-16/h2-9,16H,10H2,1H3

SMILES: COc1ccc(cc1)C1CC(=O)c2ccccc2O1

Synonyms:

• 2-(4-methoxyphenyl)-2,3-dihydro-4H-chromen-4-one

4'-Methoxyflavanone

CAS: 97005-76-0

4'-Methoxyflavanone analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.

Formula: C₁₆H₁₄O₃

Purity: (HPLC) ≥95%

Color and Shape: Powder

Molecular weight: 254.29

Ref: 11-1185

2-(4-methoxyphenyl)-3,4-dihydro-2H-1-benzopyran-4-one

CAS: 97005-76-0

Formula: C₁₆H₁₄O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 254.2806

Ref: IN-DA01H6ZJ

4'-Methoxyflavanone

CAS: 97005-76-0

4'-Methoxyflavanone

Purity: ≥98%

Molecular weight: 254.28g/mol

Ref: 54-BUP00206

4'-Methoxyflavanone

CAS: 97005-76-0

4'-Methoxyflavanone is a flavonoid isolated from natural Isaria fumosorosea KCH J2, which is used in the study of metabolic and cardiovascular diseases.

Formula: C₁₆H₁₄O₃

Purity: 99.9%

Color and Shape: Solid

Molecular weight: 254.28

Ref: TM-TN3050

4'-Methoxyflavanone

CAS: 97005-76-0

4'-Methoxyflavanone is a methoxy-substituted flavanone, which is a specialized class of flavonoids. These compounds are primarily derived from plant sources and are known for their diverse biological activities. The modification of the flavanone structure with a methoxy group can significantly influence its biochemical interactions and properties.

Formula: C₁₆H₁₄O₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 254.28 g/mol

Ref: 3D-FM67336