CAS 97009-67-1

1-(4-fluorophenyl)cyclopropanecarbonitrile

Description:

1-(4-Fluorophenyl)cyclopropanecarbonitrile, identified by its CAS number 97009-67-1, is an organic compound characterized by the presence of a cyclopropane ring attached to a carbonitrile functional group and a para-fluorophenyl substituent. This compound typically exhibits a molecular structure that includes a three-membered cyclopropane ring, which contributes to its unique reactivity and strain characteristics. The presence of the fluorine atom on the phenyl ring can influence the compound's electronic properties, potentially enhancing its lipophilicity and affecting its interactions in biological systems. As a nitrile, it features a carbon triple-bonded to a nitrogen atom, which can participate in various chemical reactions, including nucleophilic additions and hydrolysis. The compound may be of interest in medicinal chemistry and materials science due to its potential applications in drug development and as a building block in organic synthesis. Its physical properties, such as solubility and boiling point, would depend on the specific molecular interactions and the presence of functional groups.

Formula: C₁₀H₈FN

InChI: InChI=1/C10H8FN/c11-9-3-1-8(2-4-9)10(7-12)5-6-10/h1-4H,5-6H2

SMILES: c1cc(ccc1C1(CC1)C#N)F

Synonyms:

• Cyclopropanecarbonitrile, 1-(4-Fluorophenyl)-
• 1-(4-Fluorophenyl)cyclopropylnitrile
• 1-(4-FLUORO-PHENYL)-CYCLOPROPANECARBONITRILE
• 1-(4-fluorophenyl)-1-cyclopropanecarbonitrile

1-(4-Fluorophenyl)cyclopropanecarbonitrile

CAS: 97009-67-1

Formula: C₁₀H₈FN

Purity: 98%

Color and Shape: Liquid

Molecular weight: 161.1756

Ref: IN-DA006NZG

1-(4-Fluorophenyl)cyclopropanecarbonitrile

CAS: 97009-67-1

1-(4-Fluorophenyl)cyclopropanecarbonitrile

Purity: 98%

Color and Shape: Liquid

Molecular weight: 161.18g/mol

Ref: 54-PC32217

1-(4-FLUOROPHENYL)CYCLOPROPANECARBONITRILE

CAS: 97009-67-1

Formula: C₁₀H₈FN

Purity: 98%

Color and Shape: Liquid

Molecular weight: 161.179

Ref: 10-F331022