CAS 97036-66-3
:Silane, dichlorodipentyl-, homopolymer
Description:
Silane, dichlorodipentyl-, homopolymer, identified by CAS number 97036-66-3, is a polymeric compound characterized by its silane functional groups and a backbone derived from dichlorodipentyl silane. This substance typically exhibits properties such as good thermal stability, chemical resistance, and hydrophobicity, making it suitable for various applications in coatings, adhesives, and sealants. The presence of silane groups enhances adhesion to substrates, particularly in composite materials, while the polymeric structure contributes to its mechanical strength and flexibility. Additionally, this homopolymer may demonstrate compatibility with other materials, allowing for the formulation of composite systems with tailored properties. Its synthesis often involves polymerization processes that can be influenced by factors such as temperature, catalysts, and reaction conditions. Overall, silane, dichlorodipentyl-, homopolymer is valued in industrial applications for its unique combination of chemical and physical properties, which can be optimized for specific uses in materials science and engineering.
Formula:(C10H22Cl2Si)x
InChI:InChI=1S/C10H22Cl2Si/c1-3-5-7-9-13(11,12)10-8-6-4-2/h3-10H2,1-2H3
InChI key:InChIKey=QCBOFFVPUUXQEA-UHFFFAOYSA-N
SMILES:C([Si](CCCCC)(Cl)Cl)CCCC
Synonyms:- Dichlorodipentylsilane homopolymer
- Dipentylsilane homopolymer
- Dichlorodi-n-pentylsilane homopolymer
- Silane, dichlorodipentyl-, homopolymer
- Dipentyldichlorosilane homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
