CAS 97036-67-4
:Silane, dichlorodihexyl-, homopolymer
Description:
Silane, dichlorodihexyl-, homopolymer, identified by CAS number 97036-67-4, is a polymeric compound characterized by its silane functional groups and a backbone derived from dichlorodihexyl units. This substance typically exhibits properties such as good thermal stability, chemical resistance, and hydrophobicity, making it suitable for various applications in coatings, adhesives, and sealants. The presence of silane groups enhances adhesion to substrates, particularly in composite materials, while the polymer structure contributes to its mechanical strength and flexibility. Additionally, the dichlorodihexyl moiety may impart specific characteristics related to its molecular weight and chain length, influencing its processing and performance in different environments. Overall, this homopolymer is valued in industrial applications for its unique combination of properties, which can be tailored through modifications in its synthesis and formulation.
Formula:(C12H26Cl2Si)x
InChI:InChI=1S/C12H26Cl2Si/c1-3-5-7-9-11-15(13,14)12-10-8-6-4-2/h3-12H2,1-2H3
InChI key:InChIKey=NRAYZPGATNMOSB-UHFFFAOYSA-N
SMILES:C([Si](CCCCCC)(Cl)Cl)CCCCC
Synonyms:- Poly(dichlorodihexylsilane)
- Dichlorodi-n-hexylsilane polymer
- Dichlorodihexylsilane homopolymer
- Dichlorodi-n-hexylsilane homopolymer
- Silane, dichlorodihexyl-, homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
