
CAS 97042-50-7
:4-Amino-N-(2,5-dimethylphenyl)benzamide
Description:
4-Amino-N-(2,5-dimethylphenyl)benzamide, with the CAS number 97042-50-7, is an organic compound characterized by its amine and amide functional groups. It features a benzene ring substituted with an amino group (-NH2) and an amide group (-C(=O)NH-) linked to a 2,5-dimethylphenyl moiety. This structure contributes to its potential as a pharmaceutical intermediate or in various chemical syntheses. The presence of the amino group suggests it may exhibit basic properties, while the amide group can influence its solubility and reactivity. The compound is likely to be solid at room temperature and may have moderate solubility in polar solvents due to hydrogen bonding capabilities. Its molecular structure indicates potential for biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken. Overall, 4-Amino-N-(2,5-dimethylphenyl)benzamide is a compound of interest in both synthetic and applied chemistry contexts.
Formula:C15H16N2O
InChI:InChI=1S/C15H16N2O/c1-10-3-4-11(2)14(9-10)17-15(18)12-5-7-13(16)8-6-12/h3-9H,16H2,1-2H3,(H,17,18)
InChI key:InChIKey=GPTABHRVACSPGP-UHFFFAOYSA-N
SMILES:N(C(=O)C1=CC=C(N)C=C1)C2=C(C)C=CC(C)=C2
Synonyms:- 4-Amino-N-(2,5-dimethylphenyl)benzamide
- Benzamide, 4-amino-N-(2,5-dimethylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.