CAS 97055-05-5
:N-(2-ethyl-6-methylphenyl)-2-hydroxyacetamide
Description:
N-(2-ethyl-6-methylphenyl)-2-hydroxyacetamide, identified by its CAS number 97055-05-5, is an organic compound characterized by its amide functional group, which is derived from the reaction of a carboxylic acid and an amine. This compound features a phenyl ring substituted with both ethyl and methyl groups, contributing to its hydrophobic characteristics. The presence of a hydroxy group (-OH) attached to the acetamide moiety enhances its potential for hydrogen bonding, which can influence its solubility and reactivity. Typically, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical applications. The molecular structure suggests that it may have moderate polarity, allowing for interactions with both hydrophilic and hydrophobic environments. Additionally, the specific arrangement of substituents can affect its physical properties, such as melting point and boiling point, as well as its behavior in various chemical reactions. Overall, N-(2-ethyl-6-methylphenyl)-2-hydroxyacetamide represents a class of compounds that may have diverse applications in medicinal chemistry and material science.
Formula:C11H15NO2
InChI:InChI=1/C11H15NO2/c1-3-9-6-4-5-8(2)11(9)12-10(14)7-13/h4-6,13H,3,7H2,1-2H3,(H,12,14)
SMILES:CCc1cccc(C)c1N=C(CO)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
S-Metolachlor CGA 37735
CAS:Formula:C11H15NO2Color and Shape:Colourless CrystallineMolecular weight:193.242-Hydroxy-2'-ethyl-6'-methylacetanilide
CAS:Controlled ProductFormula:C11H15NO2Color and Shape:NeatMolecular weight:193.24

