CAS 97055-84-0

4-methyl-2-oxo-2H-chromen-7-yl 2-(trimethylammonio)ethyl phosphate

Description:

4-Methyl-2-oxo-2H-chromen-7-yl 2-(trimethylammonio)ethyl phosphate, with the CAS number 97055-84-0, is a chemical compound that features a chromenone structure, which is characterized by a fused benzopyran ring system. This compound contains a methyl group at the 4-position and a ketone functionality at the 2-position of the chromenone, contributing to its reactivity and potential biological activity. The presence of a trimethylammonioethyl group indicates that it has quaternary ammonium characteristics, which can enhance its solubility in polar solvents and may influence its interaction with biological membranes. Additionally, the phosphate moiety suggests potential applications in biochemistry, particularly in the context of cellular signaling or as a phospholipid analog. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its unique structural features could also facilitate interactions with various biomolecules, potentially leading to diverse biological effects.

Formula: C₁₅H₂₀NO₆P

InChI: InChI=1/C15H20NO6P/c1-11-9-15(17)21-14-10-12(5-6-13(11)14)22-23(18,19)20-8-7-16(2,3)4/h5-6,9-10H,7-8H2,1-4H3

SMILES: Cc1cc(=O)oc2cc(ccc12)OP(=O)([O-])OCC[N+](C)(C)C

4-Methylumbelliferyl phosphocholine

CAS: 97055-84-0

4-Methylumbelliferyl phosphocholine

Molecular weight: 341.30g/mol

Ref: 54-BIM4180

4-Methylumbelliferyl Phosphocholine

CAS: 97055-84-0

Molecular weight: 341.26

Ref: 7W-GT7241

4-Methylumbelliferyl cholin phosphate

CAS: 97055-84-0

4-Methylumbelliferyl phosphocholine, commonly known as 4-MUPC, is a synthetic phosphodiester used as an enzyme substrate for phospholipase enzymes. 4-MUPC is used as a fluorogenic substrate to measure the activity of phopholipases, which are important mediators of cell signalling.

Formula: C₁₅H₂₀NO₆P

Purity: Min. 99.0 Area-%

Molecular weight: 341.30 g/mol

Ref: 3D-M-5528

4-Methylumbelliferyl Phosphocholine

Controlled Product

CAS: 97055-84-0

Formula: C₁₅H₂₀NO₆P

Color and Shape: Neat

Molecular weight: 341.30

Ref: TR-M334800