CAS 97058-30-5

gamma-glutamyl-S-(2-chloro-1,1,2-trifluoroethyl)cysteinylglycine

Description:

Gamma-glutamyl-S-(2-chloro-1,1,2-trifluoroethyl)cysteinylglycine, identified by its CAS number 97058-30-5, is a synthetic compound that belongs to the class of peptides. It features a gamma-glutamyl group linked to a cysteinylglycine moiety, which contributes to its unique biochemical properties. The presence of the 2-chloro-1,1,2-trifluoroethyl substituent introduces significant lipophilicity and potential reactivity, making it of interest in medicinal chemistry and biochemistry. This compound may exhibit specific interactions with biological systems, potentially influencing enzyme activity or cellular signaling pathways. Its structure suggests that it could participate in various chemical reactions, including nucleophilic substitutions due to the electrophilic nature of the trifluoroethyl group. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Overall, gamma-glutamyl-S-(2-chloro-1,1,2-trifluoroethyl)cysteinylglycine represents a complex molecule with potential applications in drug development and biochemical research.

Formula: C₁₂H₁₇ClF₃N₃O₆S

InChI: InChI=1/C12H17ClF3N3O6S/c13-11(14)12(15,16)26-4-6(9(23)18-3-8(21)22)19-7(20)2-1-5(17)10(24)25/h5-6,11H,1-4,17H2,(H,18,23)(H,19,20)(H,21,22)(H,24,25)

SMILES: C(CC(=NC(CSC(C(Cl)F)(F)F)C(=NCC(=O)O)O)O)C(C(=O)O)N