CAS 97070-79-6
:(R)-(+)-4-chloromandelonitrile
Description:
(R)-(+)-4-chloromandelonitrile, with the CAS number 97070-79-6, is a chiral organic compound characterized by its specific stereochemistry and functional groups. It features a chlorinated aromatic ring and a nitrile group, which contribute to its reactivity and potential applications in organic synthesis. The presence of the chiral center allows for the existence of enantiomers, making it significant in fields such as pharmaceuticals, where chirality can influence biological activity. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. Its solubility in organic solvents and limited solubility in water are typical for compounds with similar structures. The compound's reactivity can be attributed to the nitrile group, which can participate in various chemical reactions, including nucleophilic additions. Overall, (R)-(+)-4-chloromandelonitrile is of interest in synthetic organic chemistry and may serve as an intermediate in the production of more complex molecules.
Formula:C8H6ClNO
InChI:InChI=1/C8H6ClNO/c9-7-3-1-6(2-4-7)8(11)5-10/h1-4,8,11H/t8-/m0/s1
SMILES:c1cc(ccc1[C@H](C#N)O)Cl
Synonyms:- (2R)-(4-chlorophenyl)(hydroxy)ethanenitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
