CAS 97073-15-9
:3-(1-Pyrrolidinyl)-2-butanone
Description:
3-(1-Pyrrolidinyl)-2-butanone, also known by its CAS number 97073-15-9, is a chemical compound characterized by its pyrrolidine ring and ketone functional group. This substance typically appears as a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents and exhibits moderate polarity due to the presence of the carbonyl group. The compound is of interest in various fields, including organic synthesis and medicinal chemistry, where it may serve as an intermediate in the production of pharmaceuticals or other bioactive molecules. Its structure allows for potential interactions with biological systems, making it a candidate for further research in drug development. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose risks if inhaled or ingested. Proper storage and handling protocols are essential to ensure safety in laboratory environments.
Formula:C8H15NO
InChI:InChI=1S/C8H15NO/c1-7(8(2)10)9-5-3-4-6-9/h7H,3-6H2,1-2H3
InChI key:InChIKey=IXYTUYCLJBLYKD-UHFFFAOYSA-N
SMILES:C(C(C)=O)(C)N1CCCC1
Synonyms:- 2-Butanone, 3-(1-pyrrolidinyl)- (6CI,9CI)
- 3-(1-Pyrrolidinyl)-2-butanone
- 2-Butanone, 3-(1-pyrrolidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.