CAS 97096-16-7

1,4-dioxaspiro[4.5]decan-8-amine

Description:

1,4-Dioxaspiro[4.5]decan-8-amine is a chemical compound characterized by its unique spirocyclic structure, which includes a dioxane moiety and an amine functional group. The presence of the dioxane ring contributes to its stability and solubility in various organic solvents. This compound typically exhibits moderate polarity due to the dioxane and amine functionalities, which can engage in hydrogen bonding. Its spirocyclic nature may impart interesting conformational properties, influencing its reactivity and interaction with biological systems. The amine group suggests potential basicity and nucleophilicity, making it a candidate for various chemical reactions, including alkylation and acylation. Additionally, compounds with similar structures have been explored for applications in medicinal chemistry, particularly in the development of pharmaceuticals. However, specific biological activity and toxicity profiles would require further investigation through empirical studies. Overall, 1,4-dioxaspiro[4.5]decan-8-amine represents a structurally intriguing compound with potential applications in organic synthesis and medicinal chemistry.

Formula: C₈H₁₅NO₂

InChI: InChI=1/C8H15NO2/c9-7-1-3-8(4-2-7)10-5-6-11-8/h7H,1-6,9H2

SMILES: C1CC2(CCC1N)OCCO2

Synonyms:

• 1,4-Dioxaspiro[4.5]Dec-8-Ylamine

1,4-dioxaspiro[4.5]decan-8-amine

CAS: 97096-16-7

Formula: C₈H₁₅NO₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 157.2102

Ref: IN-DA003NHA

1,4-Dioxa-spiro[4.5]dec-8-ylamine

CAS: 97096-16-7

1,4-Dioxa-spiro[4.5]dec-8-ylamine

Purity: 98%

Molecular weight: 157.21g/mol

Ref: 54-OR952834

1,4-DIOXASPIRO[4.5]DECAN-8-AMINE

CAS: 97096-16-7

Formula: C₈H₁₅NO₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 157.213

Ref: 10-F304786