CAS 971-21-1

ethyl N-alpha-benzoyl-L-arginate hydrochloride

Description:

Ethyl N-alpha-benzoyl-L-arginate hydrochloride, with the CAS number 971-21-1, is a chemical compound that serves primarily as a local anesthetic and is often used in pharmaceutical formulations. It is a derivative of the amino acid L-arginine, modified with a benzoyl group and an ethyl ester, which enhances its lipophilicity and bioavailability. This compound typically appears as a white to off-white crystalline powder and is soluble in water and organic solvents, making it suitable for various applications in drug delivery systems. Its mechanism of action involves blocking sodium channels, thereby inhibiting nerve impulse transmission, which results in localized numbness. Additionally, it is important to handle this substance with care, as it may have specific safety and toxicity profiles that necessitate proper laboratory practices. Overall, ethyl N-alpha-benzoyl-L-arginate hydrochloride is valued in medicinal chemistry for its anesthetic properties and potential therapeutic applications.

Formula: C₁₅H₂₂N₄O₃

InChI: InChI=1/C15H22N4O3/c1-2-22-14(21)12(9-6-10-18-15(16)17)19-13(20)11-7-4-3-5-8-11/h3-5,7-8,12H,2,6,9-10H2,1H3,(H,19,20)(H4,16,17,18)/t12-/m0/s1

SMILES: CCOC(=O)[C@H](CCCNC(=N)N)N=C(c1ccccc1)O

Synonyms:

• N-alpha-Benzoyl-L-arginine ethyl ester hydrochloride