
CAS 971-74-4
:Serotonin creatinine sulfate
Description:
Serotonin creatinine sulfate, with the CAS number 971-74-4, is a chemical compound that combines serotonin, a neurotransmitter involved in regulating mood, with creatinine sulfate, a derivative of creatinine often associated with muscle metabolism. This compound is typically studied in the context of its biological roles and potential implications in neurochemistry and physiology. Serotonin itself is known for its influence on mood, anxiety, and overall emotional well-being, while creatinine serves as a marker for kidney function and muscle mass. The sulfate group in this compound may affect its solubility and biological activity. In research, serotonin creatinine sulfate may be investigated for its potential effects on neurotransmission and its role in various physiological processes. However, detailed studies on this specific compound are limited, and its practical applications or therapeutic uses are not well-established in the literature. As with many biochemical substances, understanding its characteristics requires further exploration of its interactions and effects within biological systems.
Formula:C10H12N2O·C4H7N3O·H2O4S
InChI:InChI=1S/C10H12N2O.C4H7N3O.H2O4S/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10;1-7-2-3(8)6-4(7)5;1-5(2,3)4/h1-2,5-6,12-13H,3-4,11H2;2H2,1H3,(H2,5,6,8);(H2,1,2,3,4)
InChI key:InChIKey=WFZKRNIMSVDNBU-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)O.NC=1N(C)CC(=O)N1.C(CN)C=1C=2C(NC1)=CC=C(O)C2
Synonyms:- 4H-Imidazol-4-one, 2-amino-1,5-dihydro-1-methyl-, compd. with 3-(2-aminoethyl)-1H-indol-5-ol sulfate (salt) (1:1:1)
- Creatinine, sulfate, compd. with 3-(2-aminoethyl)-5-indolol
- 4H-Imidazol-4-one, 2-amino-1,5-dihydro-1-methyl-, compd. with 3-(2-aminoethyl)-1H-indol-5-ol sulfate (1:1:1)
- Creatinine, sulfate (1:1), compd. with 3-(2-aminoethyl)indol-5-ol (1:1)
- Indol-5-ol, 3-(2-aminoethyl)-, compd. with creatinine (1:1), sulfate (1:1) (salt)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Serotonin creatine sulphate
CAS:Controlled ProductSerotonin creatine sulphate (SS) is a chemical compound that contains nitrogen atoms. It is most stable in the crystalline form and has an optimum concentration of 0.1 M. SS is used for wastewater treatment and can be added to cellulose to make it more resistant to sulfuric acid, hydrogen fluoride, and other chemicals. SS reacts with sulfuric acid to produce hydrogen gas and surface methodology. This chemical also has high resistance because of its intramolecular hydrogen bonds.Formula:C10H12N2O·C4H7N3O·H2SO4Purity:Min. 95%Molecular weight:387.41 g/mol
