CymitQuimica logo

CAS 97106-80-4

:

1-(2-fluorophenyl)-6-methoxy-2-phenyl-1,2,3,4-tetrahydroisoquinoline

Description:
1-(2-Fluorophenyl)-6-methoxy-2-phenyl-1,2,3,4-tetrahydroisoquinoline is a chemical compound characterized by its complex structure, which includes a tetrahydroisoquinoline core. This compound features a fluorophenyl group and a methoxy group, contributing to its unique chemical properties. The presence of the fluorine atom can enhance lipophilicity and influence the compound's biological activity, while the methoxy group may affect its solubility and reactivity. The tetrahydroisoquinoline framework is often associated with various pharmacological activities, making such compounds of interest in medicinal chemistry. The compound's molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, its synthesis and characterization would typically involve standard organic chemistry techniques, including reactions that form carbon-carbon and carbon-nitrogen bonds. Overall, this compound exemplifies the diversity of organic molecules that can be synthesized for research in drug development and other applications.
Formula:C22H20FNO
InChI:InChI=1/C22H20FNO/c1-25-18-11-12-19-16(15-18)13-14-24(17-7-3-2-4-8-17)22(19)20-9-5-6-10-21(20)23/h2-12,15,22H,13-14H2,1H3
SMILES:COc1ccc2c(CCN(c3ccccc3)C2c2ccccc2F)c1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.