CAS 97135-12-1

8,9,10,11-tetrahydrodibenzo[a,h]acridine

Description:

8,9,10,11-tetrahydrodibenzo[a,h]acridine is a polycyclic aromatic compound characterized by its complex fused ring structure, which consists of multiple benzene rings. This compound features a tetrahydro configuration, indicating the presence of four hydrogen atoms that saturate the double bonds in the acridine framework, resulting in a more stable, saturated form. It is typically a solid at room temperature and may exhibit a range of physical properties such as solubility in organic solvents. The compound is of interest in various fields, including organic chemistry and materials science, due to its potential applications in organic electronics, photonics, and as a building block for more complex molecular architectures. Its unique structure may also impart interesting electronic and optical properties, making it a subject of study in the development of new materials. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity.

Formula: C₂₁H₁₇N

InChI: InChI=1/C21H17N/c1-3-7-17-14(5-1)11-12-20-19(17)13-16-10-9-15-6-2-4-8-18(15)21(16)22-20/h1,3,5,7,9-13H,2,4,6,8H2

SMILES: c1ccc2c(c1)ccc1c2cc2ccc3CCCCc3c2n1

8,9,10,11-Tetrahydrodibenz(a,h)acridine

Controlled Product

CAS: 97135-12-1

Stability Store in Freezer
Applications This compound is an interesting intermediate in the synthesiis of the epoxy-diol derivtives of dibenz(a,h)acridine (Catalogue number D41690) which is the proximate or ultimate carcinogen.
References S. Kumar: JOC, 50, 3070-3073 (1985)

Formula: C₂₁H₁₇N

Color and Shape: Neat

Molecular weight: 283.37

Ref: TR-T293400