CAS 97145-52-3
:methyl (1S,4aS)-1-(beta-D-glucopyranosyloxy)-6-hydroxy-5-{[(2E)-3-(4-methoxyphenyl)prop-2-enoyl]oxy}-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate
Description:
The chemical substance with the name "methyl (1S,4aS)-1-(beta-D-glucopyranosyloxy)-6-hydroxy-5-{[(2E)-3-(4-methoxyphenyl)prop-2-enoyl]oxy}-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate" and CAS number 97145-52-3 is a complex organic compound characterized by its intricate structure, which includes multiple functional groups such as a glucopyranosyl moiety, a methoxyphenyl group, and various hydroxyl and ester functionalities. This compound is likely to exhibit significant biological activity due to its structural features, which may influence its interaction with biological targets. The presence of the glucopyranosyl group suggests potential solubility in aqueous environments, while the methoxyphenyl group may contribute to its lipophilicity and overall pharmacokinetic properties. Additionally, the hexahydrocyclopenta structure indicates a degree of saturation, which can affect the compound's stability and reactivity. Overall, this substance may be of interest in fields such as medicinal chemistry and pharmacology, particularly in the development of new therapeutic agents.
Formula:C27H34O13
InChI:InChI=1/C27H34O13/c1-12-18-19(24(20(12)30)39-17(29)9-6-13-4-7-14(35-2)8-5-13)15(25(34)36-3)11-37-26(18)40-27-23(33)22(32)21(31)16(10-28)38-27/h4-9,11-12,16,18-24,26-28,30-33H,10H2,1-3H3/b9-6+/t12?,16-,18?,19-,20?,21-,22+,23-,24?,26+,27+/m1/s1
Synonyms:- Cyclopenta[c]pyran-4-carboxylic acid, 1-(β-D-glucopyranosyloxy)-1,4a,5,6,7,7a-hexahydro-6-hydroxy-5-[[(2E)-3-(4-methoxyphenyl)-1-oxo-2-propen-1-yl]oxy]-7-methyl-, methyl ester, (1S,4aS,5S,6R,7R,7aR)-
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Arbortristoside A
CAS:Arbortristoside A: anti-inflammatory, antinociceptive, inhibits prostaglandin/histamine/serotonin, aids peptic ulcer healing.Formula:C27H34O13Color and Shape:SolidMolecular weight:566.55
