CymitQuimica logo

CAS 97164-96-0

:

1H-Azepine-4-carboxylicacid, hexahydro-

Description:
1H-Azepine-4-carboxylic acid, hexahydro- is a cyclic compound characterized by a seven-membered ring structure containing nitrogen. This compound features a carboxylic acid functional group, which contributes to its acidity and reactivity. The hexahydro designation indicates that the compound is fully saturated, meaning it contains no double or triple bonds within the ring. This saturation typically enhances the stability of the molecule. The presence of the nitrogen atom in the ring structure can influence the compound's chemical properties, such as its basicity and potential for forming hydrogen bonds. Additionally, the carboxylic acid group can participate in various chemical reactions, including esterification and amidation. The compound may have applications in pharmaceuticals or organic synthesis due to its unique structural features. However, specific information regarding its physical properties, such as melting point, boiling point, and solubility, would require further investigation or empirical data. Overall, 1H-Azepine-4-carboxylic acid, hexahydro- is a versatile compound with potential utility in various chemical contexts.
Formula:C7H13NO2
InChI:InChI=1S/C7H13NO2/c9-7(10)6-2-1-4-8-5-3-6/h6,8H,1-5H2,(H,9,10)
InChI key:InChIKey=BCVGGQNBSCMMPV-UHFFFAOYSA-N
SMILES:C(O)(=O)C1CCCNCC1
Synonyms:
  • 1H-Azepine-4-carboxylic acid, hexahydro-
  • 1H-Azepine-4-carboxylicacid,hexahydro-(9CI)
  • Azepane-4-carboxylic acid
  • Hexahydro-1H-azepine-4-carboxylic acid
Found 4 products.