CAS 97170-19-9
:(6R,7R)-7-[[(2E)-2-(2-Furanyl)-2-(methoxyimino)acetyl]amino]-3-(hydroxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
Description:
The chemical substance known as "(6R,7R)-7-[[(2E)-2-(2-Furanyl)-2-(methoxyimino)acetyl]amino]-3-(hydroxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid," with the CAS number 97170-19-9, is a complex bicyclic compound featuring a thiazolidine ring structure. This compound is characterized by its oxo and carboxylic acid functional groups, which contribute to its potential biological activity. The presence of a furanyl group and a methoxyimino moiety suggests that it may exhibit unique reactivity and interaction profiles, possibly influencing its pharmacological properties. The stereochemistry indicated by the (6R,7R) configuration implies specific spatial arrangements that can affect the compound's interactions with biological targets. Such compounds are often investigated for their potential as antibiotics or other therapeutic agents, particularly due to their structural similarities to known bioactive molecules. Overall, this substance represents a class of compounds that may have significant implications in medicinal chemistry and drug development.
Formula:C15H15N3O7S
InChI:InChI=1S/C15H15N3O7S/c1-24-17-9(8-3-2-4-25-8)12(20)16-10-13(21)18-11(15(22)23)7(5-19)6-26-14(10)18/h2-4,10,14,19H,5-6H2,1H3,(H,16,20)(H,22,23)/b17-9+/t10-,14-/m1/s1
InChI key:InChIKey=OUSLHGWWWMRAIG-OGAOBHAHSA-N
SMILES:C(O)(=O)C=1N2[C@@]([C@H](NC(/C(=N/OC)/C3=CC=CO3)=O)C2=O)(SCC1CO)[H]
Synonyms:- 5-Thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 7-[[(2E)-2-(2-furanyl)-2-(methoxyimino)acetyl]amino]-3-(hydroxymethyl)-8-oxo-, (6R,7R)-
- 5-Thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 7-[[2-furanyl(methoxyimino)acetyl]amino]-3-(hydroxymethyl)-8-oxo-, [6R-[6α,7β(E)]]-
- (6R,7R)-7-[[(2E)-2-(2-Furanyl)-2-(methoxyimino)acetyl]amino]-3-(hydroxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

