CAS 97170-41-7
:(3Z)-4-{4-[2-(dimethylamino)ethoxy]phenyl}-3,4-diphenylbut-3-en-2-ol
Description:
The chemical substance known as (3Z)-4-{4-[2-(dimethylamino)ethoxy]phenyl}-3,4-diphenylbut-3-en-2-ol, with the CAS number 97170-41-7, is characterized by its complex organic structure, which includes multiple aromatic rings and functional groups. This compound features a butenol moiety, indicating the presence of a double bond and an alcohol group, which contributes to its reactivity and potential biological activity. The dimethylamino group suggests that it may exhibit basic properties, potentially influencing its solubility and interaction with biological systems. The ethoxy group enhances its lipophilicity, which can affect its pharmacokinetics. The presence of multiple phenyl groups may contribute to its stability and influence its electronic properties. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where its interactions with biological targets could be explored. Further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C26H29NO2
InChI:InChI=1/C26H29NO2/c1-20(28)25(21-10-6-4-7-11-21)26(22-12-8-5-9-13-22)23-14-16-24(17-15-23)29-19-18-27(2)3/h4-17,20,28H,18-19H2,1-3H3/b26-25+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(Z)-alpha-Hydroxy Tamoxifen
CAS:Controlled ProductFormula:C26H29NO2Color and Shape:NeatMolecular weight:387.51
