
CAS 97171-76-1
:1,1′-[Oxybis(2,1-ethanediyloxy-2,1-ethanediyl)] dioctanoate
Description:
1,1′-[Oxybis(2,1-ethanediyloxy-2,1-ethanediyl)] dioctanoate, with CAS number 97171-76-1, is a synthetic compound characterized by its ester functional groups and ether linkages. This substance is typically used as a surfactant or emulsifier in various applications, including cosmetics, pharmaceuticals, and industrial formulations. Its molecular structure features a central oxybis unit connecting two long hydrocarbon chains derived from octanoic acid, which contributes to its hydrophobic properties. The presence of multiple ether linkages enhances its solubility in organic solvents while maintaining some degree of hydrophilicity due to the ether groups. This dual nature allows it to effectively stabilize emulsions and improve the texture of formulations. Additionally, the compound is generally considered to have low toxicity, making it suitable for use in consumer products. However, like many chemical substances, its environmental impact and biodegradability should be assessed in the context of its application. Overall, this compound exemplifies the versatility of synthetic esters in modern chemistry.
Formula:C24H46O7
InChI:InChI=1S/C24H46O7/c1-3-5-7-9-11-13-23(25)30-21-19-28-17-15-27-16-18-29-20-22-31-24(26)14-12-10-8-6-4-2/h3-22H2,1-2H3
InChI key:InChIKey=SILFDXJGXXAUGY-UHFFFAOYSA-N
SMILES:C(OCCOCCOCCOCCOC(CCCCCCC)=O)(CCCCCCC)=O
Synonyms:- 1,1′-[Oxybis(2,1-ethanediyloxy-2,1-ethanediyl)] dioctanoate
- Octanoic acid, 1,1′-[oxybis(2,1-ethanediyloxy-2,1-ethanediyl)] ester
- Tetraethylene glycol dioctanoate
- Octanoic acid, oxybis(2,1-ethanediyloxy-2,1-ethanediyl) ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
OXYBIS(ETHANE-1,2-DIYLOXYETHANE-1,2-DIYL) DIOCTANOATE
CAS:Formula:C24H46O7Molecular weight:446.6178399999997
